C15H29F3IN3O3 — CID 111746504
3-(2-methoxyethoxymethyl)-N'-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111746504) has the molecular formula C15H29F3IN3O3 and a molecular weight of 483.31 g/mol. Its IUPAC name is 3-(2-methoxyethoxymethyl)-N'-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | 3-(2-methoxyethoxymethyl)-N'-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111746504 |
| Molecular Formula | C15H29F3IN3O3 |
| Molecular Weight | 483.31 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | 3-(2-methoxyethoxymethyl)-N'-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCCOCC(F)(F)F)N1CCC(COCCOC)C1.I |
| InChI | InChI=1S/C15H28F3N3O3.HI/c1-19-14(20-5-3-7-24-12-15(16,17)18)21-6-4-13(10-21)11-23-9-8-22-2;/h13H,3-12H2,1-2H3,(H,19,20);1H |
| InChIKey | LYPMHCBAPQLRSD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|