C18H21N3O3 — CID 11174815
4-(piperazine-1-carbonyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylic acid (PubChem CID 11174815) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 4-(piperazine-1-carbonyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylic acid.
| Compound Name | 4-(piperazine-1-carbonyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylic acid |
|---|---|
| PubChem CID | 11174815 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 4-(piperazine-1-carbonyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C1C=CCC1C(C(=O)N1CCNCC1)N2 |
| InChI | InChI=1S/C18H21N3O3/c22-17(21-8-6-19-7-9-21)16-13-3-1-2-12(13)14-10-11(18(23)24)4-5-15(14)20-16/h1-2,4-5,10,12-13,16,19-20H,3,6-9H2,(H,23,24) |
| InChIKey | PEMRMUMRRYEKMN-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|