C19H29Cl2N3O2 — CID 111748562
N'-[2-(3,5-dichlorophenyl)ethyl]-N-ethyl-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide (PubChem CID 111748562) has the molecular formula C19H29Cl2N3O2 and a molecular weight of 402.37 g/mol. Its IUPAC name is N'-[2-(3,5-dichlorophenyl)ethyl]-N-ethyl-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-[2-(3,5-dichlorophenyl)ethyl]-N-ethyl-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111748562 |
| Molecular Formula | C19H29Cl2N3O2 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | N'-[2-(3,5-dichlorophenyl)ethyl]-N-ethyl-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1cc(Cl)cc(Cl)c1)N1CCC(COCCOC)C1 |
| InChI | InChI=1S/C19H29Cl2N3O2/c1-3-22-19(23-6-4-15-10-17(20)12-18(21)11-15)24-7-5-16(13-24)14-26-9-8-25-2/h10-12,16H,3-9,13-14H2,1-2H3,(H,22,23) |
| InChIKey | OUWLHFZVBRXNMA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|