C17H17NO6 — CID 11174931
diethyl 2-[(5-oxo-3-phenyl-2H-1,2-oxazol-4-yl)methylidene]propanedioate (PubChem CID 11174931) has the molecular formula C17H17NO6 and a molecular weight of 331.32 g/mol. Its IUPAC name is diethyl 2-[(5-oxo-3-phenyl-2H-1,2-oxazol-4-yl)methylidene]propanedioate.
| Compound Name | diethyl 2-[(5-oxo-3-phenyl-2H-1,2-oxazol-4-yl)methylidene]propanedioate |
|---|---|
| PubChem CID | 11174931 |
| Molecular Formula | C17H17NO6 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | diethyl 2-[(5-oxo-3-phenyl-2H-1,2-oxazol-4-yl)methylidene]propanedioate |
| SMILES | CCOC(=O)C(=Cc1c(-c2ccccc2)[nH]oc1=O)C(=O)OCC |
| InChI | InChI=1S/C17H17NO6/c1-3-22-15(19)13(16(20)23-4-2)10-12-14(18-24-17(12)21)11-8-6-5-7-9-11/h5-10,18H,3-4H2,1-2H3 |
| InChIKey | HLLCJVONRBOTKC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 98.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|