C23H33IN4O2S — CID 111749678
N-ethyl-N'-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111749678) has the molecular formula C23H33IN4O2S and a molecular weight of 556.51 g/mol. Its IUPAC name is N-ethyl-N'-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111749678 |
| Molecular Formula | C23H33IN4O2S |
| Molecular Weight | 556.51 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | N-ethyl-N'-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccnc1OCCOC)N1CCC(CSc2ccccc2)C1.I |
| InChI | InChI=1S/C23H32N4O2S.HI/c1-3-24-23(26-16-20-8-7-12-25-22(20)29-15-14-28-2)27-13-11-19(17-27)18-30-21-9-5-4-6-10-21;/h4-10,12,19H,3,11,13-18H2,1-2H3,(H,24,26);1H |
| InChIKey | UEVODMZCKSZWJA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 58.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|