C16H16BrNO2 — CID 11175000
[(3R,4R)-4-bromo-2,3-diphenyl-1,2-oxazolidin-4-yl]methanol (PubChem CID 11175000) has the molecular formula C16H16BrNO2 and a molecular weight of 334.21 g/mol. Its IUPAC name is [(3R,4R)-4-bromo-2,3-diphenyl-1,2-oxazolidin-4-yl]methanol.
| Compound Name | [(3R,4R)-4-bromo-2,3-diphenyl-1,2-oxazolidin-4-yl]methanol |
|---|---|
| PubChem CID | 11175000 |
| Molecular Formula | C16H16BrNO2 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | [(3R,4R)-4-bromo-2,3-diphenyl-1,2-oxazolidin-4-yl]methanol |
| SMILES | OC[C@@]1(Br)CON(c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H16BrNO2/c17-16(11-19)12-20-18(14-9-5-2-6-10-14)15(16)13-7-3-1-4-8-13/h1-10,15,19H,11-12H2/t15-,16-/m1/s1 |
| InChIKey | JMWQEFPNYNFNOC-HZPDHXFCSA-N |
| XLogP | 3.31 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|