C26H37N5O — CID 111751711
N,N-dimethyl-2-[[N-(2-phenylethyl)-N'-[[4-(piperidin-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]acetamide (PubChem CID 111751711) has the molecular formula C26H37N5O and a molecular weight of 435.62 g/mol. Its IUPAC name is N,N-dimethyl-2-[[N-(2-phenylethyl)-N'-[[4-(piperidin-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[N-(2-phenylethyl)-N'-[[4-(piperidin-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111751711 |
| Molecular Formula | C26H37N5O |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 435.30 |
| IUPAC Name | N,N-dimethyl-2-[[N-(2-phenylethyl)-N'-[[4-(piperidin-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]acetamide |
| SMILES | CN(C)C(=O)CN/C(=N/Cc1ccc(CN2CCCCC2)cc1)NCCc1ccccc1 |
| InChI | InChI=1S/C26H37N5O/c1-30(2)25(32)20-29-26(27-16-15-22-9-5-3-6-10-22)28-19-23-11-13-24(14-12-23)21-31-17-7-4-8-18-31/h3,5-6,9-14H,4,7-8,15-21H2,1-2H3,(H2,27,28,29) |
| InChIKey | ZUWLIKSQPJIHKO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|