C15H21IN4 — CID 111751877
1,1-diethyl-2-(quinolin-4-ylmethyl)guanidine;hydroiodide (PubChem CID 111751877) has the molecular formula C15H21IN4 and a molecular weight of 384.27 g/mol. Its IUPAC name is 1,1-diethyl-2-(quinolin-4-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1,1-diethyl-2-(quinolin-4-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111751877 |
| Molecular Formula | C15H21IN4 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 1,1-diethyl-2-(quinolin-4-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN(CC)/C(N)=N/Cc1ccnc2ccccc12.I |
| InChI | InChI=1S/C15H20N4.HI/c1-3-19(4-2)15(16)18-11-12-9-10-17-14-8-6-5-7-13(12)14;/h5-10H,3-4,11H2,1-2H3,(H2,16,18);1H |
| InChIKey | OPUZISWYIMQDPI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 54.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|