C14H26F3IN4 — CID 111752908
1-cyclopropyl-2-methyl-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine;hydroiodide (PubChem CID 111752908) has the molecular formula C14H26F3IN4 and a molecular weight of 434.29 g/mol. Its IUPAC name is 1-cyclopropyl-2-methyl-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-2-methyl-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111752908 |
| Molecular Formula | C14H26F3IN4 |
| Molecular Weight | 434.29 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 1-cyclopropyl-2-methyl-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCC1CCN(CC(F)(F)F)CC1)NC1CC1.I |
| InChI | InChI=1S/C14H25F3N4.HI/c1-18-13(20-12-2-3-12)19-7-4-11-5-8-21(9-6-11)10-14(15,16)17;/h11-12H,2-10H2,1H3,(H2,18,19,20);1H |
| InChIKey | XRNGFSHHCGFVRW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|