About 1-butan-2-yl-2-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine
1-butan-2-yl-2-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine (PubChem CID 111752911) has the molecular formula C14H27F3N4
and a molecular weight of 308.39 g/mol. Its IUPAC name is 1-butan-2-yl-2-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine.
Molecular Properties
| Compound Name | 1-butan-2-yl-2-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine |
| PubChem CID | 111752911 |
| Molecular Formula | C14H27F3N4 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 1-butan-2-yl-2-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine |
| SMILES | CCC(C)N/C(N)=N/CCC1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C14H27F3N4/c1-3-11(2)20-13(18)19-7-4-12-5-8-21(9-6-12)10-14(15,16)17/h11-12H,3-10H2,1-2H3,(H3,18,19,20) |
| InChIKey | KQAWFWJBOBJTCJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-butan-2-yl-2-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-yl-2-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine?
The IUPAC name of 1-butan-2-yl-2-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine (CID 111752911) is 1-butan-2-yl-2-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine.
What is the SMILES notation for 1-butan-2-yl-2-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine?
The canonical SMILES for 1-butan-2-yl-2-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine is CCC(C)N/C(N)=N/CCC1CCN(CC(F)(F)F)CC1.
What is the InChIKey of 1-butan-2-yl-2-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine?
The InChIKey is KQAWFWJBOBJTCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27F3N4/c1-3-11(2)20-13(18)19-7-4-12-5-8-21(9-6-12)10-14(15,16)17/h11-12H,3-10H2,1-2H3,(H3,18,19,20).
What are the key properties of 1-butan-2-yl-2-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine?
1-butan-2-yl-2-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine has a molecular weight of 308.39 g/mol, XLogP of 2.35, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-yl-2-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine is sourced from PubChem (CID 111752911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).