C25H32IN5O — CID 111753406
1-ethyl-3-[3-(1H-indol-3-yl)propyl]-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111753406) has the molecular formula C25H32IN5O and a molecular weight of 545.47 g/mol. Its IUPAC name is 1-ethyl-3-[3-(1H-indol-3-yl)propyl]-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-(1H-indol-3-yl)propyl]-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111753406 |
| Molecular Formula | C25H32IN5O |
| Molecular Weight | 545.47 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | 1-ethyl-3-[3-(1H-indol-3-yl)propyl]-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCCC2=O)cc1)NCCCc1c[nH]c2ccccc12.I |
| InChI | InChI=1S/C25H31N5O.HI/c1-2-26-25(27-15-5-7-20-18-28-23-9-4-3-8-22(20)23)29-17-19-11-13-21(14-12-19)30-16-6-10-24(30)31;/h3-4,8-9,11-14,18,28H,2,5-7,10,15-17H2,1H3,(H2,26,27,29);1H |
| InChIKey | PLHXNROTRFJFOT-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|