About 3-bromo-1,5-dichloro-2-nitro-4-propylsulfanylbenzene
3-bromo-1,5-dichloro-2-nitro-4-propylsulfanylbenzene (PubChem CID 11175364) has the molecular formula C9H8BrCl2NO2S
and a molecular weight of 345.05 g/mol. Its IUPAC name is 3-bromo-1,5-dichloro-2-nitro-4-propylsulfanylbenzene.
Molecular Properties
| Compound Name | 3-bromo-1,5-dichloro-2-nitro-4-propylsulfanylbenzene |
| PubChem CID | 11175364 |
| Molecular Formula | C9H8BrCl2NO2S |
| Molecular Weight | 345.05 g/mol |
| Exact Mass | 342.88 |
| IUPAC Name | 3-bromo-1,5-dichloro-2-nitro-4-propylsulfanylbenzene |
| SMILES | CCCSc1c(Cl)cc(Cl)c([N+](=O)[O-])c1Br |
| InChI | InChI=1S/C9H8BrCl2NO2S/c1-2-3-16-9-6(12)4-5(11)8(7(9)10)13(14)15/h4H,2-3H2,1H3 |
| InChIKey | SOVTXAITCVCRCC-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.05 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-1,5-dichloro-2-nitro-4-propylsulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1,5-dichloro-2-nitro-4-propylsulfanylbenzene?
The IUPAC name of 3-bromo-1,5-dichloro-2-nitro-4-propylsulfanylbenzene (CID 11175364) is 3-bromo-1,5-dichloro-2-nitro-4-propylsulfanylbenzene.
What is the SMILES notation for 3-bromo-1,5-dichloro-2-nitro-4-propylsulfanylbenzene?
The canonical SMILES for 3-bromo-1,5-dichloro-2-nitro-4-propylsulfanylbenzene is CCCSc1c(Cl)cc(Cl)c([N+](=O)[O-])c1Br.
What is the InChIKey of 3-bromo-1,5-dichloro-2-nitro-4-propylsulfanylbenzene?
The InChIKey is SOVTXAITCVCRCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrCl2NO2S/c1-2-3-16-9-6(12)4-5(11)8(7(9)10)13(14)15/h4H,2-3H2,1H3.
What are the key properties of 3-bromo-1,5-dichloro-2-nitro-4-propylsulfanylbenzene?
3-bromo-1,5-dichloro-2-nitro-4-propylsulfanylbenzene has a molecular weight of 345.05 g/mol, XLogP of 5.17, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1,5-dichloro-2-nitro-4-propylsulfanylbenzene is sourced from PubChem (CID 11175364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).