C17H14FNO4S — CID 11175434
2-[2-fluoro-2-(4-methoxyphenyl)sulfinylethyl]isoindole-1,3-dione (PubChem CID 11175434) has the molecular formula C17H14FNO4S and a molecular weight of 347.37 g/mol. Its IUPAC name is 2-[2-fluoro-2-(4-methoxyphenyl)sulfinylethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-fluoro-2-(4-methoxyphenyl)sulfinylethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11175434 |
| Molecular Formula | C17H14FNO4S |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 2-[2-fluoro-2-(4-methoxyphenyl)sulfinylethyl]isoindole-1,3-dione |
| SMILES | COc1ccc(S(=O)C(F)CN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C17H14FNO4S/c1-23-11-6-8-12(9-7-11)24(22)15(18)10-19-16(20)13-4-2-3-5-14(13)17(19)21/h2-9,15H,10H2,1H3 |
| InChIKey | ZZVWGNHAUYXCHN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|