C19H25NO5 — CID 11175444
(3R,4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(2R)-2-hydroxypent-4-enyl]-3-phenoxyazetidin-2-one (PubChem CID 11175444) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is (3R,4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(2R)-2-hydroxypent-4-enyl]-3-phenoxyazetidin-2-one.
| Compound Name | (3R,4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(2R)-2-hydroxypent-4-enyl]-3-phenoxyazetidin-2-one |
|---|---|
| PubChem CID | 11175444 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (3R,4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(2R)-2-hydroxypent-4-enyl]-3-phenoxyazetidin-2-one |
| SMILES | C=CC[C@@H](O)CN1C(=O)[C@H](Oc2ccccc2)[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C19H25NO5/c1-4-8-13(21)11-20-16(15-12-23-19(2,3)25-15)17(18(20)22)24-14-9-6-5-7-10-14/h4-7,9-10,13,15-17,21H,1,8,11-12H2,2-3H3/t13-,15-,16+,17-/m1/s1 |
| InChIKey | AVWHHYCXJMCCGN-MXASKKJJSA-N |
| XLogP | 1.73 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|