About 5-amino-3-propyl-1-(2,4,6-trichlorophenyl)pyrazole-4-carboxamide
5-amino-3-propyl-1-(2,4,6-trichlorophenyl)pyrazole-4-carboxamide (PubChem CID 11175453) has the molecular formula C13H13Cl3N4O
and a molecular weight of 347.63 g/mol. Its IUPAC name is 5-amino-3-propyl-1-(2,4,6-trichlorophenyl)pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-amino-3-propyl-1-(2,4,6-trichlorophenyl)pyrazole-4-carboxamide |
| PubChem CID | 11175453 |
| Molecular Formula | C13H13Cl3N4O |
| Molecular Weight | 347.63 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 5-amino-3-propyl-1-(2,4,6-trichlorophenyl)pyrazole-4-carboxamide |
| SMILES | CCCc1nn(-c2c(Cl)cc(Cl)cc2Cl)c(N)c1C(N)=O |
| InChI | InChI=1S/C13H13Cl3N4O/c1-2-3-9-10(13(18)21)12(17)20(19-9)11-7(15)4-6(14)5-8(11)16/h4-5H,2-3,17H2,1H3,(H2,18,21) |
| InChIKey | JCXYENSXFBJXMH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.63 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-amino-3-propyl-1-(2,4,6-trichlorophenyl)pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-3-propyl-1-(2,4,6-trichlorophenyl)pyrazole-4-carboxamide?
The IUPAC name of 5-amino-3-propyl-1-(2,4,6-trichlorophenyl)pyrazole-4-carboxamide (CID 11175453) is 5-amino-3-propyl-1-(2,4,6-trichlorophenyl)pyrazole-4-carboxamide.
What is the SMILES notation for 5-amino-3-propyl-1-(2,4,6-trichlorophenyl)pyrazole-4-carboxamide?
The canonical SMILES for 5-amino-3-propyl-1-(2,4,6-trichlorophenyl)pyrazole-4-carboxamide is CCCc1nn(-c2c(Cl)cc(Cl)cc2Cl)c(N)c1C(N)=O.
What is the InChIKey of 5-amino-3-propyl-1-(2,4,6-trichlorophenyl)pyrazole-4-carboxamide?
The InChIKey is JCXYENSXFBJXMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13Cl3N4O/c1-2-3-9-10(13(18)21)12(17)20(19-9)11-7(15)4-6(14)5-8(11)16/h4-5H,2-3,17H2,1H3,(H2,18,21).
What are the key properties of 5-amino-3-propyl-1-(2,4,6-trichlorophenyl)pyrazole-4-carboxamide?
5-amino-3-propyl-1-(2,4,6-trichlorophenyl)pyrazole-4-carboxamide has a molecular weight of 347.63 g/mol, XLogP of 3.47, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3-propyl-1-(2,4,6-trichlorophenyl)pyrazole-4-carboxamide is sourced from PubChem (CID 11175453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).