C24H41N5 — CID 111755327
1-[[2-(azepan-1-ylmethyl)phenyl]methyl]-2-methyl-3-(1-propan-2-ylpiperidin-4-yl)guanidine (PubChem CID 111755327) has the molecular formula C24H41N5 and a molecular weight of 399.63 g/mol. Its IUPAC name is 1-[[2-(azepan-1-ylmethyl)phenyl]methyl]-2-methyl-3-(1-propan-2-ylpiperidin-4-yl)guanidine.
| Compound Name | 1-[[2-(azepan-1-ylmethyl)phenyl]methyl]-2-methyl-3-(1-propan-2-ylpiperidin-4-yl)guanidine |
|---|---|
| PubChem CID | 111755327 |
| Molecular Formula | C24H41N5 |
| Molecular Weight | 399.63 g/mol |
| Exact Mass | 399.34 |
| IUPAC Name | 1-[[2-(azepan-1-ylmethyl)phenyl]methyl]-2-methyl-3-(1-propan-2-ylpiperidin-4-yl)guanidine |
| SMILES | C/N=C(\NCc1ccccc1CN1CCCCCC1)NC1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C24H41N5/c1-20(2)29-16-12-23(13-17-29)27-24(25-3)26-18-21-10-6-7-11-22(21)19-28-14-8-4-5-9-15-28/h6-7,10-11,20,23H,4-5,8-9,12-19H2,1-3H3,(H2,25,26,27) |
| InChIKey | UZLHLCJDJUJPTN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.63 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|