C19H32ClIN4O — CID 111755386
1-[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]-3-[3-(cyclopropylmethoxy)propyl]-2-methylguanidine;hydroiodide (PubChem CID 111755386) has the molecular formula C19H32ClIN4O and a molecular weight of 494.85 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]-3-[3-(cyclopropylmethoxy)propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]-3-[3-(cyclopropylmethoxy)propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111755386 |
| Molecular Formula | C19H32ClIN4O |
| Molecular Weight | 494.85 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]-3-[3-(cyclopropylmethoxy)propyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCC1CC1)NCC(c1ccc(Cl)cc1)N(C)C.I |
| InChI | InChI=1S/C19H31ClN4O.HI/c1-21-19(22-11-4-12-25-14-15-5-6-15)23-13-18(24(2)3)16-7-9-17(20)10-8-16;/h7-10,15,18H,4-6,11-14H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | PZTPECLCJDEXAW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.85 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|