C21H28N2O2 — CID 111755539
1-(3-methoxyphenyl)-2-[[1-(2-phenylethyl)pyrrolidin-3-yl]amino]ethanol (PubChem CID 111755539) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-2-[[1-(2-phenylethyl)pyrrolidin-3-yl]amino]ethanol.
| Compound Name | 1-(3-methoxyphenyl)-2-[[1-(2-phenylethyl)pyrrolidin-3-yl]amino]ethanol |
|---|---|
| PubChem CID | 111755539 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 1-(3-methoxyphenyl)-2-[[1-(2-phenylethyl)pyrrolidin-3-yl]amino]ethanol |
| SMILES | COc1cccc(C(O)CNC2CCN(CCc3ccccc3)C2)c1 |
| InChI | InChI=1S/C21H28N2O2/c1-25-20-9-5-8-18(14-20)21(24)15-22-19-11-13-23(16-19)12-10-17-6-3-2-4-7-17/h2-9,14,19,21-22,24H,10-13,15-16H2,1H3 |
| InChIKey | OCTFMMPDEFYPHC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |