About 2-(7-methoxy-1,9-dimethylpyrido[3,4-b]indol-2-ium-2-yl)ethanol bromide
2-(7-methoxy-1,9-dimethylpyrido[3,4-b]indol-2-ium-2-yl)ethanol bromide (PubChem CID 11175558) has the molecular formula C16H19BrN2O2
and a molecular weight of 351.24 g/mol. Its IUPAC name is 2-(7-methoxy-1,9-dimethylpyrido[3,4-b]indol-2-ium-2-yl)ethanol bromide.
Molecular Properties
| Compound Name | 2-(7-methoxy-1,9-dimethylpyrido[3,4-b]indol-2-ium-2-yl)ethanol bromide |
| PubChem CID | 11175558 |
| Molecular Formula | C16H19BrN2O2 |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 2-(7-methoxy-1,9-dimethylpyrido[3,4-b]indol-2-ium-2-yl)ethanol bromide |
| SMILES | COc1ccc2c3cc[n+](CCO)c(C)c3n(C)c2c1.[Br-] |
| InChI | InChI=1S/C16H19N2O2.BrH/c1-11-16-14(6-7-18(11)8-9-19)13-5-4-12(20-3)10-15(13)17(16)2;/h4-7,10,19H,8-9H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | MOWMUIHCHMFZEF-UHFFFAOYSA-M |
| XLogP | -1.07 |
| TPSA | 38.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(7-methoxy-1,9-dimethylpyrido[3,4-b]indol-2-ium-2-yl)ethanol bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-methoxy-1,9-dimethylpyrido[3,4-b]indol-2-ium-2-yl)ethanol bromide?
The IUPAC name of 2-(7-methoxy-1,9-dimethylpyrido[3,4-b]indol-2-ium-2-yl)ethanol bromide (CID 11175558) is 2-(7-methoxy-1,9-dimethylpyrido[3,4-b]indol-2-ium-2-yl)ethanol bromide.
What is the SMILES notation for 2-(7-methoxy-1,9-dimethylpyrido[3,4-b]indol-2-ium-2-yl)ethanol bromide?
The canonical SMILES for 2-(7-methoxy-1,9-dimethylpyrido[3,4-b]indol-2-ium-2-yl)ethanol bromide is COc1ccc2c3cc[n+](CCO)c(C)c3n(C)c2c1.[Br-].
What is the InChIKey of 2-(7-methoxy-1,9-dimethylpyrido[3,4-b]indol-2-ium-2-yl)ethanol bromide?
The InChIKey is MOWMUIHCHMFZEF-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H19N2O2.BrH/c1-11-16-14(6-7-18(11)8-9-19)13-5-4-12(20-3)10-15(13)17(16)2;/h4-7,10,19H,8-9H2,1-3H3;1H/q+1;/p-1.
What are the key properties of 2-(7-methoxy-1,9-dimethylpyrido[3,4-b]indol-2-ium-2-yl)ethanol bromide?
2-(7-methoxy-1,9-dimethylpyrido[3,4-b]indol-2-ium-2-yl)ethanol bromide has a molecular weight of 351.24 g/mol, XLogP of -1.07, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-methoxy-1,9-dimethylpyrido[3,4-b]indol-2-ium-2-yl)ethanol bromide is sourced from PubChem (CID 11175558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).