C22H25NO3 — CID 11175570
(1S,2R,5S,10S,11S,14R,15R)-11-(4-methylphenyl)-12,18-dioxa-3-azapentacyclo[13.2.1.02,14.03,11.05,10]octadec-16-en-4-one (PubChem CID 11175570) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is (1S,2R,5S,10S,11S,14R,15R)-11-(4-methylphenyl)-12,18-dioxa-3-azapentacyclo[13.2.1.02,14.03,11.05,10]octadec-16-en-4-one.
| Compound Name | (1S,2R,5S,10S,11S,14R,15R)-11-(4-methylphenyl)-12,18-dioxa-3-azapentacyclo[13.2.1.02,14.03,11.05,10]octadec-16-en-4-one |
|---|---|
| PubChem CID | 11175570 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | (1S,2R,5S,10S,11S,14R,15R)-11-(4-methylphenyl)-12,18-dioxa-3-azapentacyclo[13.2.1.02,14.03,11.05,10]octadec-16-en-4-one |
| SMILES | Cc1ccc([C@]23OC[C@H]4[C@H]([C@@H]5C=C[C@H]4O5)N2C(=O)[C@H]2CCCC[C@@H]23)cc1 |
| InChI | InChI=1S/C22H25NO3/c1-13-6-8-14(9-7-13)22-17-5-3-2-4-15(17)21(24)23(22)20-16(12-25-22)18-10-11-19(20)26-18/h6-11,15-20H,2-5,12H2,1H3/t15-,16+,17-,18+,19-,20+,22+/m0/s1 |
| InChIKey | AVSBDFUGYPEQQC-ZAKJYJBGSA-N |
| XLogP | 3.15 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|