C18H27NO6 — CID 11175642
(3S,5R)-2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4-dimethoxyoxazinan-5-ol (PubChem CID 11175642) has the molecular formula C18H27NO6 and a molecular weight of 353.42 g/mol. Its IUPAC name is (3S,5R)-2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4-dimethoxyoxazinan-5-ol.
| Compound Name | (3S,5R)-2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4-dimethoxyoxazinan-5-ol |
|---|---|
| PubChem CID | 11175642 |
| Molecular Formula | C18H27NO6 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | (3S,5R)-2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4-dimethoxyoxazinan-5-ol |
| SMILES | COC1(OC)[C@H](O)CON(Cc2ccccc2)[C@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C18H27NO6/c1-17(2)23-11-14(25-17)16-18(21-3,22-4)15(20)12-24-19(16)10-13-8-6-5-7-9-13/h5-9,14-16,20H,10-12H2,1-4H3/t14-,15-,16+/m1/s1 |
| InChIKey | UNBLOXACQMBGHX-OAGGEKHMSA-N |
| XLogP | 1.30 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|