About tert-butyl 4-[N'-(2,2-difluoroethyl)carbamimidoyl]piperazine-1-carboxylate
tert-butyl 4-[N'-(2,2-difluoroethyl)carbamimidoyl]piperazine-1-carboxylate (PubChem CID 111757674) has the molecular formula C12H22F2N4O2
and a molecular weight of 292.33 g/mol. Its IUPAC name is tert-butyl 4-[N'-(2,2-difluoroethyl)carbamimidoyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[N'-(2,2-difluoroethyl)carbamimidoyl]piperazine-1-carboxylate |
| PubChem CID | 111757674 |
| Molecular Formula | C12H22F2N4O2 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | tert-butyl 4-[N'-(2,2-difluoroethyl)carbamimidoyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(/C(N)=N/CC(F)F)CC1 |
| InChI | InChI=1S/C12H22F2N4O2/c1-12(2,3)20-11(19)18-6-4-17(5-7-18)10(15)16-8-9(13)14/h9H,4-8H2,1-3H3,(H2,15,16) |
| InChIKey | DKLLMZRYAANJHX-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-[N'-(2,2-difluoroethyl)carbamimidoyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[N'-(2,2-difluoroethyl)carbamimidoyl]piperazine-1-carboxylate?
The IUPAC name of tert-butyl 4-[N'-(2,2-difluoroethyl)carbamimidoyl]piperazine-1-carboxylate (CID 111757674) is tert-butyl 4-[N'-(2,2-difluoroethyl)carbamimidoyl]piperazine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[N'-(2,2-difluoroethyl)carbamimidoyl]piperazine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[N'-(2,2-difluoroethyl)carbamimidoyl]piperazine-1-carboxylate is CC(C)(C)OC(=O)N1CCN(/C(N)=N/CC(F)F)CC1.
What is the InChIKey of tert-butyl 4-[N'-(2,2-difluoroethyl)carbamimidoyl]piperazine-1-carboxylate?
The InChIKey is DKLLMZRYAANJHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F2N4O2/c1-12(2,3)20-11(19)18-6-4-17(5-7-18)10(15)16-8-9(13)14/h9H,4-8H2,1-3H3,(H2,15,16).
What are the key properties of tert-butyl 4-[N'-(2,2-difluoroethyl)carbamimidoyl]piperazine-1-carboxylate?
tert-butyl 4-[N'-(2,2-difluoroethyl)carbamimidoyl]piperazine-1-carboxylate has a molecular weight of 292.33 g/mol, XLogP of 1.12, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[N'-(2,2-difluoroethyl)carbamimidoyl]piperazine-1-carboxylate is sourced from PubChem (CID 111757674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).