C21H33NO2Si — CID 11175815
(4S,6S,8S,8aS)-6-tert-butyl-4-phenyl-8-(trimethylsilylmethyl)-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-1-one (PubChem CID 11175815) has the molecular formula C21H33NO2Si and a molecular weight of 359.59 g/mol. Its IUPAC name is (4S,6S,8S,8aS)-6-tert-butyl-4-phenyl-8-(trimethylsilylmethyl)-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-1-one.
| Compound Name | (4S,6S,8S,8aS)-6-tert-butyl-4-phenyl-8-(trimethylsilylmethyl)-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-1-one |
|---|---|
| PubChem CID | 11175815 |
| Molecular Formula | C21H33NO2Si |
| Molecular Weight | 359.59 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | (4S,6S,8S,8aS)-6-tert-butyl-4-phenyl-8-(trimethylsilylmethyl)-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-1-one |
| SMILES | CC(C)(C)[C@@H]1C[C@H](C[Si](C)(C)C)[C@H]2C(=O)OC[C@H](c3ccccc3)N21 |
| InChI | InChI=1S/C21H33NO2Si/c1-21(2,3)18-12-16(14-25(4,5)6)19-20(23)24-13-17(22(18)19)15-10-8-7-9-11-15/h7-11,16-19H,12-14H2,1-6H3/t16-,17-,18+,19+/m1/s1 |
| InChIKey | UHFVXYFCFIPJSB-YRXWBPOGSA-N |
| XLogP | 4.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.59 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|