C21H31IN4O3 — CID 111758459
tert-butyl N-[2-[[N-ethyl-N'-(furan-2-ylmethyl)carbamimidoyl]amino]-1-phenylethyl]carbamate;hydroiodide (PubChem CID 111758459) has the molecular formula C21H31IN4O3 and a molecular weight of 514.41 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-ethyl-N'-(furan-2-ylmethyl)carbamimidoyl]amino]-1-phenylethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N-ethyl-N'-(furan-2-ylmethyl)carbamimidoyl]amino]-1-phenylethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111758459 |
| Molecular Formula | C21H31IN4O3 |
| Molecular Weight | 514.41 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | tert-butyl N-[2-[[N-ethyl-N'-(furan-2-ylmethyl)carbamimidoyl]amino]-1-phenylethyl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccco1)NCC(NC(=O)OC(C)(C)C)c1ccccc1.I |
| InChI | InChI=1S/C21H30N4O3.HI/c1-5-22-19(23-14-17-12-9-13-27-17)24-15-18(16-10-7-6-8-11-16)25-20(26)28-21(2,3)4;/h6-13,18H,5,14-15H2,1-4H3,(H,25,26)(H2,22,23,24);1H |
| InChIKey | DGMXZSOYIWXFSV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|