C13H25IN4OS — CID 111758479
1-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-3-ethyl-2-(2-methoxyethyl)guanidine;hydroiodide (PubChem CID 111758479) has the molecular formula C13H25IN4OS and a molecular weight of 412.34 g/mol. Its IUPAC name is 1-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-3-ethyl-2-(2-methoxyethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-3-ethyl-2-(2-methoxyethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111758479 |
| Molecular Formula | C13H25IN4OS |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 1-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-3-ethyl-2-(2-methoxyethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCOC)NCCc1sc(C)nc1C.I |
| InChI | InChI=1S/C13H24N4OS.HI/c1-5-14-13(16-8-9-18-4)15-7-6-12-10(2)17-11(3)19-12;/h5-9H2,1-4H3,(H2,14,15,16);1H |
| InChIKey | JWQALDBLJXTODI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|