C18H29N3OS — CID 111758780
2-(2-benzylsulfinylethyl)-1-cyclohexyl-3-ethylguanidine (PubChem CID 111758780) has the molecular formula C18H29N3OS and a molecular weight of 335.52 g/mol. Its IUPAC name is 2-(2-benzylsulfinylethyl)-1-cyclohexyl-3-ethylguanidine.
| Compound Name | 2-(2-benzylsulfinylethyl)-1-cyclohexyl-3-ethylguanidine |
|---|---|
| PubChem CID | 111758780 |
| Molecular Formula | C18H29N3OS |
| Molecular Weight | 335.52 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 2-(2-benzylsulfinylethyl)-1-cyclohexyl-3-ethylguanidine |
| SMILES | CCN/C(=N\CCS(=O)Cc1ccccc1)NC1CCCCC1 |
| InChI | InChI=1S/C18H29N3OS/c1-2-19-18(21-17-11-7-4-8-12-17)20-13-14-23(22)15-16-9-5-3-6-10-16/h3,5-6,9-10,17H,2,4,7-8,11-15H2,1H3,(H2,19,20,21) |
| InChIKey | COBONXNTSMCQIU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.52 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|