About [(2S,4S)-3,3-difluoro-4-phenylmethoxythiolan-2-yl]methyl benzoate
[(2S,4S)-3,3-difluoro-4-phenylmethoxythiolan-2-yl]methyl benzoate (PubChem CID 11175969) has the molecular formula C19H18F2O3S
and a molecular weight of 364.41 g/mol. Its IUPAC name is [(2S,4S)-3,3-difluoro-4-phenylmethoxythiolan-2-yl]methyl benzoate.
Molecular Properties
| Compound Name | [(2S,4S)-3,3-difluoro-4-phenylmethoxythiolan-2-yl]methyl benzoate |
| PubChem CID | 11175969 |
| Molecular Formula | C19H18F2O3S |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | [(2S,4S)-3,3-difluoro-4-phenylmethoxythiolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@@H]1SC[C@@H](OCc2ccccc2)C1(F)F)c1ccccc1 |
| InChI | InChI=1S/C19H18F2O3S/c20-19(21)16(23-11-14-7-3-1-4-8-14)13-25-17(19)12-24-18(22)15-9-5-2-6-10-15/h1-10,16-17H,11-13H2/t16-,17+/m1/s1 |
| InChIKey | LAOPXMQTLFANLE-SJORKVTESA-N |
| XLogP | 4.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2S,4S)-3,3-difluoro-4-phenylmethoxythiolan-2-yl]methyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,4S)-3,3-difluoro-4-phenylmethoxythiolan-2-yl]methyl benzoate?
The IUPAC name of [(2S,4S)-3,3-difluoro-4-phenylmethoxythiolan-2-yl]methyl benzoate (CID 11175969) is [(2S,4S)-3,3-difluoro-4-phenylmethoxythiolan-2-yl]methyl benzoate.
What is the SMILES notation for [(2S,4S)-3,3-difluoro-4-phenylmethoxythiolan-2-yl]methyl benzoate?
The canonical SMILES for [(2S,4S)-3,3-difluoro-4-phenylmethoxythiolan-2-yl]methyl benzoate is O=C(OC[C@@H]1SC[C@@H](OCc2ccccc2)C1(F)F)c1ccccc1.
What is the InChIKey of [(2S,4S)-3,3-difluoro-4-phenylmethoxythiolan-2-yl]methyl benzoate?
The InChIKey is LAOPXMQTLFANLE-SJORKVTESA-N. The full InChI is InChI=1S/C19H18F2O3S/c20-19(21)16(23-11-14-7-3-1-4-8-14)13-25-17(19)12-24-18(22)15-9-5-2-6-10-15/h1-10,16-17H,11-13H2/t16-,17+/m1/s1.
What are the key properties of [(2S,4S)-3,3-difluoro-4-phenylmethoxythiolan-2-yl]methyl benzoate?
[(2S,4S)-3,3-difluoro-4-phenylmethoxythiolan-2-yl]methyl benzoate has a molecular weight of 364.41 g/mol, XLogP of 4.18, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,4S)-3,3-difluoro-4-phenylmethoxythiolan-2-yl]methyl benzoate is sourced from PubChem (CID 11175969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).