C22H22O5 — CID 11176036
1,6,11-trimethoxy-8-methyl-5,12-dihydrotetracene-5,12-diol (PubChem CID 11176036) has the molecular formula C22H22O5 and a molecular weight of 366.41 g/mol. Its IUPAC name is 1,6,11-trimethoxy-8-methyl-5,12-dihydrotetracene-5,12-diol.
| Compound Name | 1,6,11-trimethoxy-8-methyl-5,12-dihydrotetracene-5,12-diol |
|---|---|
| PubChem CID | 11176036 |
| Molecular Formula | C22H22O5 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 1,6,11-trimethoxy-8-methyl-5,12-dihydrotetracene-5,12-diol |
| SMILES | COc1cccc2c1C(O)c1c(c(OC)c3cc(C)ccc3c1OC)C2O |
| InChI | InChI=1S/C22H22O5/c1-11-8-9-12-14(10-11)22(27-4)17-18(21(12)26-3)20(24)16-13(19(17)23)6-5-7-15(16)25-2/h5-10,19-20,23-24H,1-4H3 |
| InChIKey | LXTGGEBVFXXBIU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |