About methyl (2S)-2-[benzyl-(2-methoxy-2-oxoethoxy)amino]-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]acetate
methyl (2S)-2-[benzyl-(2-methoxy-2-oxoethoxy)amino]-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]acetate (PubChem CID 11176063) has the molecular formula C18H25NO7
and a molecular weight of 367.40 g/mol. Its IUPAC name is methyl (2S)-2-[benzyl-(2-methoxy-2-oxoethoxy)amino]-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]acetate.
Molecular Properties
| Compound Name | methyl (2S)-2-[benzyl-(2-methoxy-2-oxoethoxy)amino]-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]acetate |
| PubChem CID | 11176063 |
| Molecular Formula | C18H25NO7 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | methyl (2S)-2-[benzyl-(2-methoxy-2-oxoethoxy)amino]-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]acetate |
| SMILES | COC(=O)CON(Cc1ccccc1)[C@H](C(=O)OC)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C18H25NO7/c1-18(2)24-11-14(26-18)16(17(21)23-4)19(25-12-15(20)22-3)10-13-8-6-5-7-9-13/h5-9,14,16H,10-12H2,1-4H3/t14-,16+/m1/s1 |
| InChIKey | JGMJLEKCUWJDPN-ZBFHGGJFSA-N |
| XLogP | 1.29 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S)-2-[benzyl-(2-methoxy-2-oxoethoxy)amino]-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-[benzyl-(2-methoxy-2-oxoethoxy)amino]-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]acetate?
The IUPAC name of methyl (2S)-2-[benzyl-(2-methoxy-2-oxoethoxy)amino]-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]acetate (CID 11176063) is methyl (2S)-2-[benzyl-(2-methoxy-2-oxoethoxy)amino]-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]acetate.
What is the SMILES notation for methyl (2S)-2-[benzyl-(2-methoxy-2-oxoethoxy)amino]-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]acetate?
The canonical SMILES for methyl (2S)-2-[benzyl-(2-methoxy-2-oxoethoxy)amino]-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]acetate is COC(=O)CON(Cc1ccccc1)[C@H](C(=O)OC)[C@H]1COC(C)(C)O1.
What is the InChIKey of methyl (2S)-2-[benzyl-(2-methoxy-2-oxoethoxy)amino]-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]acetate?
The InChIKey is JGMJLEKCUWJDPN-ZBFHGGJFSA-N. The full InChI is InChI=1S/C18H25NO7/c1-18(2)24-11-14(26-18)16(17(21)23-4)19(25-12-15(20)22-3)10-13-8-6-5-7-9-13/h5-9,14,16H,10-12H2,1-4H3/t14-,16+/m1/s1.
What are the key properties of methyl (2S)-2-[benzyl-(2-methoxy-2-oxoethoxy)amino]-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]acetate?
methyl (2S)-2-[benzyl-(2-methoxy-2-oxoethoxy)amino]-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]acetate has a molecular weight of 367.40 g/mol, XLogP of 1.29, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[benzyl-(2-methoxy-2-oxoethoxy)amino]-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]acetate is sourced from PubChem (CID 11176063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).