C19H32O5Si — CID 11176118
(1R,5S,6R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-4-(hydroxymethyl)-6-(3-methylbut-2-enyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one (PubChem CID 11176118) has the molecular formula C19H32O5Si and a molecular weight of 368.55 g/mol. Its IUPAC name is (1R,5S,6R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-4-(hydroxymethyl)-6-(3-methylbut-2-enyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one.
| Compound Name | (1R,5S,6R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-4-(hydroxymethyl)-6-(3-methylbut-2-enyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one |
|---|---|
| PubChem CID | 11176118 |
| Molecular Formula | C19H32O5Si |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | (1R,5S,6R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-4-(hydroxymethyl)-6-(3-methylbut-2-enyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| SMILES | CC(C)=CC[C@]12O[C@H]1C(=O)C(CO[Si](C)(C)C(C)(C)C)=C(CO)[C@@H]2O |
| InChI | InChI=1S/C19H32O5Si/c1-12(2)8-9-19-16(22)13(10-20)14(15(21)17(19)24-19)11-23-25(6,7)18(3,4)5/h8,16-17,20,22H,9-11H2,1-7H3/t16-,17-,19+/m0/s1 |
| InChIKey | BGMJQYCCBAKTIH-JENIJYKNSA-N |
| XLogP | 2.73 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|