About dimethyl (E)-2-[2-(1,3-dioxolan-2-yl)ethyl]-3-iodobut-2-enedioate
dimethyl (E)-2-[2-(1,3-dioxolan-2-yl)ethyl]-3-iodobut-2-enedioate (PubChem CID 11176153) has the molecular formula C11H15IO6
and a molecular weight of 370.14 g/mol. Its IUPAC name is dimethyl (E)-2-[2-(1,3-dioxolan-2-yl)ethyl]-3-iodobut-2-enedioate.
Molecular Properties
| Compound Name | dimethyl (E)-2-[2-(1,3-dioxolan-2-yl)ethyl]-3-iodobut-2-enedioate |
| PubChem CID | 11176153 |
| Molecular Formula | C11H15IO6 |
| Molecular Weight | 370.14 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | dimethyl (E)-2-[2-(1,3-dioxolan-2-yl)ethyl]-3-iodobut-2-enedioate |
| SMILES | COC(=O)/C(I)=C(/CCC1OCCO1)C(=O)OC |
| InChI | InChI=1S/C11H15IO6/c1-15-10(13)7(9(12)11(14)16-2)3-4-8-17-5-6-18-8/h8H,3-6H2,1-2H3/b9-7+ |
| InChIKey | GKAZVHNLPUCPBD-VQHVLOKHSA-N |
| XLogP | 1.17 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.14 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (E)-2-[2-(1,3-dioxolan-2-yl)ethyl]-3-iodobut-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (E)-2-[2-(1,3-dioxolan-2-yl)ethyl]-3-iodobut-2-enedioate?
The IUPAC name of dimethyl (E)-2-[2-(1,3-dioxolan-2-yl)ethyl]-3-iodobut-2-enedioate (CID 11176153) is dimethyl (E)-2-[2-(1,3-dioxolan-2-yl)ethyl]-3-iodobut-2-enedioate.
What is the SMILES notation for dimethyl (E)-2-[2-(1,3-dioxolan-2-yl)ethyl]-3-iodobut-2-enedioate?
The canonical SMILES for dimethyl (E)-2-[2-(1,3-dioxolan-2-yl)ethyl]-3-iodobut-2-enedioate is COC(=O)/C(I)=C(/CCC1OCCO1)C(=O)OC.
What is the InChIKey of dimethyl (E)-2-[2-(1,3-dioxolan-2-yl)ethyl]-3-iodobut-2-enedioate?
The InChIKey is GKAZVHNLPUCPBD-VQHVLOKHSA-N. The full InChI is InChI=1S/C11H15IO6/c1-15-10(13)7(9(12)11(14)16-2)3-4-8-17-5-6-18-8/h8H,3-6H2,1-2H3/b9-7+.
What are the key properties of dimethyl (E)-2-[2-(1,3-dioxolan-2-yl)ethyl]-3-iodobut-2-enedioate?
dimethyl (E)-2-[2-(1,3-dioxolan-2-yl)ethyl]-3-iodobut-2-enedioate has a molecular weight of 370.14 g/mol, XLogP of 1.17, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (E)-2-[2-(1,3-dioxolan-2-yl)ethyl]-3-iodobut-2-enedioate is sourced from PubChem (CID 11176153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).