C22H41N5O — CID 111761685
1-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-2-methyl-3-(6-methylheptan-2-yl)guanidine (PubChem CID 111761685) has the molecular formula C22H41N5O and a molecular weight of 391.60 g/mol. Its IUPAC name is 1-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-2-methyl-3-(6-methylheptan-2-yl)guanidine.
| Compound Name | 1-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-2-methyl-3-(6-methylheptan-2-yl)guanidine |
|---|---|
| PubChem CID | 111761685 |
| Molecular Formula | C22H41N5O |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.33 |
| IUPAC Name | 1-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-2-methyl-3-(6-methylheptan-2-yl)guanidine |
| SMILES | C/N=C(/NCC1CCN(Cc2nc(C)c(C)o2)CC1)NC(C)CCCC(C)C |
| InChI | InChI=1S/C22H41N5O/c1-16(2)8-7-9-17(3)25-22(23-6)24-14-20-10-12-27(13-11-20)15-21-26-18(4)19(5)28-21/h16-17,20H,7-15H2,1-6H3,(H2,23,24,25) |
| InChIKey | XKIMWKKMZSLZJP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|