C15H18BrNO3S — CID 11176204
(2S)-2-[[(2S)-2-[(1R)-5-bromo-2,3-dihydro-1H-inden-1-yl]-3-sulfanylpropanoyl]amino]propanoic acid (PubChem CID 11176204) has the molecular formula C15H18BrNO3S and a molecular weight of 372.28 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[(1R)-5-bromo-2,3-dihydro-1H-inden-1-yl]-3-sulfanylpropanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[(1R)-5-bromo-2,3-dihydro-1H-inden-1-yl]-3-sulfanylpropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 11176204 |
| Molecular Formula | C15H18BrNO3S |
| Molecular Weight | 372.28 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | (2S)-2-[[(2S)-2-[(1R)-5-bromo-2,3-dihydro-1H-inden-1-yl]-3-sulfanylpropanoyl]amino]propanoic acid |
| SMILES | C[C@H](NC(=O)[C@@H](CS)[C@H]1CCc2cc(Br)ccc21)C(=O)O |
| InChI | InChI=1S/C15H18BrNO3S/c1-8(15(19)20)17-14(18)13(7-21)12-4-2-9-6-10(16)3-5-11(9)12/h3,5-6,8,12-13,21H,2,4,7H2,1H3,(H,17,18)(H,19,20)/t8-,12-,13-/m0/s1 |
| InChIKey | MHVZLJWXYUFXBH-HJIKLVIJSA-N |
| XLogP | 2.61 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|