C16H33N3O — CID 111762505
2-[2-(cyclopropylmethoxy)ethyl]-1-ethyl-3-heptan-2-ylguanidine (PubChem CID 111762505) has the molecular formula C16H33N3O and a molecular weight of 283.46 g/mol. Its IUPAC name is 2-[2-(cyclopropylmethoxy)ethyl]-1-ethyl-3-heptan-2-ylguanidine.
| Compound Name | 2-[2-(cyclopropylmethoxy)ethyl]-1-ethyl-3-heptan-2-ylguanidine |
|---|---|
| PubChem CID | 111762505 |
| Molecular Formula | C16H33N3O |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.26 |
| IUPAC Name | 2-[2-(cyclopropylmethoxy)ethyl]-1-ethyl-3-heptan-2-ylguanidine |
| SMILES | CCCCCC(C)N/C(=N/CCOCC1CC1)NCC |
| InChI | InChI=1S/C16H33N3O/c1-4-6-7-8-14(3)19-16(17-5-2)18-11-12-20-13-15-9-10-15/h14-15H,4-13H2,1-3H3,(H2,17,18,19) |
| InChIKey | CBJUWEWUUXJTQD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|