C19H29IN6O — CID 111764342
1-ethyl-3-(4-methylcyclohexyl)-2-[2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111764342) has the molecular formula C19H29IN6O and a molecular weight of 484.39 g/mol. Its IUPAC name is 1-ethyl-3-(4-methylcyclohexyl)-2-[2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(4-methylcyclohexyl)-2-[2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111764342 |
| Molecular Formula | C19H29IN6O |
| Molecular Weight | 484.39 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 1-ethyl-3-(4-methylcyclohexyl)-2-[2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1noc(-c2ccccn2)n1)NC1CCC(C)CC1.I |
| InChI | InChI=1S/C19H28N6O.HI/c1-3-20-19(23-15-9-7-14(2)8-10-15)22-13-11-17-24-18(26-25-17)16-6-4-5-12-21-16;/h4-6,12,14-15H,3,7-11,13H2,1-2H3,(H2,20,22,23);1H |
| InChIKey | UFLSNQOLBSRCHN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 88.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|