C23H32N4O3S — CID 111764493
1-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-3-ethyl-2-(thiophen-2-ylmethyl)guanidine (PubChem CID 111764493) has the molecular formula C23H32N4O3S and a molecular weight of 444.60 g/mol. Its IUPAC name is 1-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-3-ethyl-2-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 1-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-3-ethyl-2-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111764493 |
| Molecular Formula | C23H32N4O3S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 1-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-3-ethyl-2-(thiophen-2-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1cccs1)NCCCC(=O)N1CCc2cc(OC)c(OC)cc2C1 |
| InChI | InChI=1S/C23H32N4O3S/c1-4-24-23(26-15-19-7-6-12-31-19)25-10-5-8-22(28)27-11-9-17-13-20(29-2)21(30-3)14-18(17)16-27/h6-7,12-14H,4-5,8-11,15-16H2,1-3H3,(H2,24,25,26) |
| InChIKey | DFQWIUAFYJPPTQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|