C20H28F2N2O3 — CID 11176504
(E)-N-[(4S,5S)-5-acetamido-6-(3,5-difluorophenyl)-4-hydroxyhexan-2-yl]hex-3-enamide (PubChem CID 11176504) has the molecular formula C20H28F2N2O3 and a molecular weight of 382.45 g/mol. Its IUPAC name is (E)-N-[(4S,5S)-5-acetamido-6-(3,5-difluorophenyl)-4-hydroxyhexan-2-yl]hex-3-enamide.
| Compound Name | (E)-N-[(4S,5S)-5-acetamido-6-(3,5-difluorophenyl)-4-hydroxyhexan-2-yl]hex-3-enamide |
|---|---|
| PubChem CID | 11176504 |
| Molecular Formula | C20H28F2N2O3 |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | (E)-N-[(4S,5S)-5-acetamido-6-(3,5-difluorophenyl)-4-hydroxyhexan-2-yl]hex-3-enamide |
| SMILES | CC/C=C/CC(=O)NC(C)C[C@H](O)[C@H](Cc1cc(F)cc(F)c1)NC(C)=O |
| InChI | InChI=1S/C20H28F2N2O3/c1-4-5-6-7-20(27)23-13(2)8-19(26)18(24-14(3)25)11-15-9-16(21)12-17(22)10-15/h5-6,9-10,12-13,18-19,26H,4,7-8,11H2,1-3H3,(H,23,27)(H,24,25)/b6-5+/t13?,18-,19-/m0/s1 |
| InChIKey | FWGFNQGAXBGWCM-GLEOPWAJSA-N |
| XLogP | 2.62 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|