About 2,7-diethynyl-9,9-dihexylfluorene
2,7-diethynyl-9,9-dihexylfluorene (PubChem CID 11176515) has the molecular formula C29H34
and a molecular weight of 382.59 g/mol. Its IUPAC name is 2,7-diethynyl-9,9-dihexylfluorene.
Molecular Properties
| Compound Name | 2,7-diethynyl-9,9-dihexylfluorene |
| PubChem CID | 11176515 |
| Molecular Formula | C29H34 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | 2,7-diethynyl-9,9-dihexylfluorene |
| SMILES | C#Cc1ccc2c(c1)C(CCCCCC)(CCCCCC)c1cc(C#C)ccc1-2 |
| InChI | InChI=1S/C29H34/c1-5-9-11-13-19-29(20-14-12-10-6-2)27-21-23(7-3)15-17-25(27)26-18-16-24(8-4)22-28(26)29/h3-4,15-18,21-22H,5-6,9-14,19-20H2,1-2H3 |
| InChIKey | YWZACOPYIXYBNQ-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,7-diethynyl-9,9-dihexylfluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-diethynyl-9,9-dihexylfluorene?
The IUPAC name of 2,7-diethynyl-9,9-dihexylfluorene (CID 11176515) is 2,7-diethynyl-9,9-dihexylfluorene.
What is the SMILES notation for 2,7-diethynyl-9,9-dihexylfluorene?
The canonical SMILES for 2,7-diethynyl-9,9-dihexylfluorene is C#Cc1ccc2c(c1)C(CCCCCC)(CCCCCC)c1cc(C#C)ccc1-2.
What is the InChIKey of 2,7-diethynyl-9,9-dihexylfluorene?
The InChIKey is YWZACOPYIXYBNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H34/c1-5-9-11-13-19-29(20-14-12-10-6-2)27-21-23(7-3)15-17-25(27)26-18-16-24(8-4)22-28(26)29/h3-4,15-18,21-22H,5-6,9-14,19-20H2,1-2H3.
What are the key properties of 2,7-diethynyl-9,9-dihexylfluorene?
2,7-diethynyl-9,9-dihexylfluorene has a molecular weight of 382.59 g/mol, XLogP of 7.86, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-diethynyl-9,9-dihexylfluorene is sourced from PubChem (CID 11176515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).