C17H19ClF2N4O2 — CID 11176598
6-[(3R)-3-aminopiperidin-1-yl]-1-[(2-chloro-3,6-difluorophenyl)methyl]-3-methylpyrimidine-2,4-dione (PubChem CID 11176598) has the molecular formula C17H19ClF2N4O2 and a molecular weight of 384.81 g/mol. Its IUPAC name is 6-[(3R)-3-aminopiperidin-1-yl]-1-[(2-chloro-3,6-difluorophenyl)methyl]-3-methylpyrimidine-2,4-dione.
| Compound Name | 6-[(3R)-3-aminopiperidin-1-yl]-1-[(2-chloro-3,6-difluorophenyl)methyl]-3-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11176598 |
| Molecular Formula | C17H19ClF2N4O2 |
| Molecular Weight | 384.81 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 6-[(3R)-3-aminopiperidin-1-yl]-1-[(2-chloro-3,6-difluorophenyl)methyl]-3-methylpyrimidine-2,4-dione |
| SMILES | Cn1c(=O)cc(N2CCC[C@@H](N)C2)n(Cc2c(F)ccc(F)c2Cl)c1=O |
| InChI | InChI=1S/C17H19ClF2N4O2/c1-22-15(25)7-14(23-6-2-3-10(21)8-23)24(17(22)26)9-11-12(19)4-5-13(20)16(11)18/h4-5,7,10H,2-3,6,8-9,21H2,1H3/t10-/m1/s1 |
| InChIKey | YMNHVOIQCOFMQC-SNVBAGLBSA-N |
| XLogP | 1.45 |
| TPSA | 73.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.81 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|