C20H44O3Si2 — CID 11176741
(E,4R,5S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylhept-2-en-1-ol (PubChem CID 11176741) has the molecular formula C20H44O3Si2 and a molecular weight of 388.74 g/mol. Its IUPAC name is (E,4R,5S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylhept-2-en-1-ol.
| Compound Name | (E,4R,5S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylhept-2-en-1-ol |
|---|---|
| PubChem CID | 11176741 |
| Molecular Formula | C20H44O3Si2 |
| Molecular Weight | 388.74 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | (E,4R,5S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylhept-2-en-1-ol |
| SMILES | C[C@H](/C=C/CO)[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H44O3Si2/c1-17(13-12-15-21)18(23-25(10,11)20(5,6)7)14-16-22-24(8,9)19(2,3)4/h12-13,17-18,21H,14-16H2,1-11H3/b13-12+/t17-,18+/m1/s1 |
| InChIKey | QXALONDOJZQWLF-QJPGBWLHSA-N |
| XLogP | 5.97 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.74 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|