About 3-bromo-1,8-dichloro-6-(4-methoxyphenyl)naphthalen-2-ol
3-bromo-1,8-dichloro-6-(4-methoxyphenyl)naphthalen-2-ol (PubChem CID 11176970) has the molecular formula C17H11BrCl2O2
and a molecular weight of 398.08 g/mol. Its IUPAC name is 3-bromo-1,8-dichloro-6-(4-methoxyphenyl)naphthalen-2-ol.
Molecular Properties
| Compound Name | 3-bromo-1,8-dichloro-6-(4-methoxyphenyl)naphthalen-2-ol |
| PubChem CID | 11176970 |
| Molecular Formula | C17H11BrCl2O2 |
| Molecular Weight | 398.08 g/mol |
| Exact Mass | 395.93 |
| IUPAC Name | 3-bromo-1,8-dichloro-6-(4-methoxyphenyl)naphthalen-2-ol |
| SMILES | COc1ccc(-c2cc(Cl)c3c(Cl)c(O)c(Br)cc3c2)cc1 |
| InChI | InChI=1S/C17H11BrCl2O2/c1-22-12-4-2-9(3-5-12)10-6-11-7-13(18)17(21)16(20)15(11)14(19)8-10/h2-8,21H,1H3 |
| InChIKey | RXCBJNIIHBZSRT-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.08 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-1,8-dichloro-6-(4-methoxyphenyl)naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1,8-dichloro-6-(4-methoxyphenyl)naphthalen-2-ol?
The IUPAC name of 3-bromo-1,8-dichloro-6-(4-methoxyphenyl)naphthalen-2-ol (CID 11176970) is 3-bromo-1,8-dichloro-6-(4-methoxyphenyl)naphthalen-2-ol.
What is the SMILES notation for 3-bromo-1,8-dichloro-6-(4-methoxyphenyl)naphthalen-2-ol?
The canonical SMILES for 3-bromo-1,8-dichloro-6-(4-methoxyphenyl)naphthalen-2-ol is COc1ccc(-c2cc(Cl)c3c(Cl)c(O)c(Br)cc3c2)cc1.
What is the InChIKey of 3-bromo-1,8-dichloro-6-(4-methoxyphenyl)naphthalen-2-ol?
The InChIKey is RXCBJNIIHBZSRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11BrCl2O2/c1-22-12-4-2-9(3-5-12)10-6-11-7-13(18)17(21)16(20)15(11)14(19)8-10/h2-8,21H,1H3.
What are the key properties of 3-bromo-1,8-dichloro-6-(4-methoxyphenyl)naphthalen-2-ol?
3-bromo-1,8-dichloro-6-(4-methoxyphenyl)naphthalen-2-ol has a molecular weight of 398.08 g/mol, XLogP of 6.29, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1,8-dichloro-6-(4-methoxyphenyl)naphthalen-2-ol is sourced from PubChem (CID 11176970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).