C19H30O5SSi — CID 11177000
[(2S,3R,4R,5S)-4-hydroxy-2-phenylsulfanyl-5-triethylsilyloxyoxan-3-yl] acetate (PubChem CID 11177000) has the molecular formula C19H30O5SSi and a molecular weight of 398.60 g/mol. Its IUPAC name is [(2S,3R,4R,5S)-4-hydroxy-2-phenylsulfanyl-5-triethylsilyloxyoxan-3-yl] acetate.
| Compound Name | [(2S,3R,4R,5S)-4-hydroxy-2-phenylsulfanyl-5-triethylsilyloxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 11177000 |
| Molecular Formula | C19H30O5SSi |
| Molecular Weight | 398.60 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | [(2S,3R,4R,5S)-4-hydroxy-2-phenylsulfanyl-5-triethylsilyloxyoxan-3-yl] acetate |
| SMILES | CC[Si](CC)(CC)O[C@H]1CO[C@@H](Sc2ccccc2)[C@H](OC(C)=O)[C@H]1O |
| InChI | InChI=1S/C19H30O5SSi/c1-5-26(6-2,7-3)24-16-13-22-19(18(17(16)21)23-14(4)20)25-15-11-9-8-10-12-15/h8-12,16-19,21H,5-7,13H2,1-4H3/t16-,17-,18+,19-/m0/s1 |
| InChIKey | XKDYOHHUPDLABI-OKYOBFRVSA-N |
| XLogP | 3.82 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.60 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|