C18H41IN4O2S — CID 111771383
1-[5-(diethylamino)pentan-2-yl]-3-(2,2-dimethyl-4-methylsulfonylbutyl)-2-methylguanidine;hydroiodide (PubChem CID 111771383) has the molecular formula C18H41IN4O2S and a molecular weight of 504.52 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-3-(2,2-dimethyl-4-methylsulfonylbutyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-3-(2,2-dimethyl-4-methylsulfonylbutyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111771383 |
| Molecular Formula | C18H41IN4O2S |
| Molecular Weight | 504.52 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-3-(2,2-dimethyl-4-methylsulfonylbutyl)-2-methylguanidine;hydroiodide |
| SMILES | CCN(CC)CCCC(C)N/C(=N\C)NCC(C)(C)CCS(C)(=O)=O.I |
| InChI | InChI=1S/C18H40N4O2S.HI/c1-8-22(9-2)13-10-11-16(3)21-17(19-6)20-15-18(4,5)12-14-25(7,23)24;/h16H,8-15H2,1-7H3,(H2,19,20,21);1H |
| InChIKey | VMBBSBMJHGUHSC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.52 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|