About 4-cyclohexyl-6-[2-(dimethylamino)-2-oxoethyl]-5-phenylthieno[2,3-b]pyrrole-2-carboxylic acid
4-cyclohexyl-6-[2-(dimethylamino)-2-oxoethyl]-5-phenylthieno[2,3-b]pyrrole-2-carboxylic acid (PubChem CID 11177350) has the molecular formula C23H26N2O3S
and a molecular weight of 410.54 g/mol. Its IUPAC name is 4-cyclohexyl-6-[2-(dimethylamino)-2-oxoethyl]-5-phenylthieno[2,3-b]pyrrole-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-cyclohexyl-6-[2-(dimethylamino)-2-oxoethyl]-5-phenylthieno[2,3-b]pyrrole-2-carboxylic acid |
| PubChem CID | 11177350 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 4-cyclohexyl-6-[2-(dimethylamino)-2-oxoethyl]-5-phenylthieno[2,3-b]pyrrole-2-carboxylic acid |
| SMILES | CN(C)C(=O)Cn1c(-c2ccccc2)c(C2CCCCC2)c2cc(C(=O)O)sc21 |
| InChI | InChI=1S/C23H26N2O3S/c1-24(2)19(26)14-25-21(16-11-7-4-8-12-16)20(15-9-5-3-6-10-15)17-13-18(23(27)28)29-22(17)25/h4,7-8,11-13,15H,3,5-6,9-10,14H2,1-2H3,(H,27,28) |
| InChIKey | OFQMOHBSPCNHAT-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-cyclohexyl-6-[2-(dimethylamino)-2-oxoethyl]-5-phenylthieno[2,3-b]pyrrole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexyl-6-[2-(dimethylamino)-2-oxoethyl]-5-phenylthieno[2,3-b]pyrrole-2-carboxylic acid?
The IUPAC name of 4-cyclohexyl-6-[2-(dimethylamino)-2-oxoethyl]-5-phenylthieno[2,3-b]pyrrole-2-carboxylic acid (CID 11177350) is 4-cyclohexyl-6-[2-(dimethylamino)-2-oxoethyl]-5-phenylthieno[2,3-b]pyrrole-2-carboxylic acid.
What is the SMILES notation for 4-cyclohexyl-6-[2-(dimethylamino)-2-oxoethyl]-5-phenylthieno[2,3-b]pyrrole-2-carboxylic acid?
The canonical SMILES for 4-cyclohexyl-6-[2-(dimethylamino)-2-oxoethyl]-5-phenylthieno[2,3-b]pyrrole-2-carboxylic acid is CN(C)C(=O)Cn1c(-c2ccccc2)c(C2CCCCC2)c2cc(C(=O)O)sc21.
What is the InChIKey of 4-cyclohexyl-6-[2-(dimethylamino)-2-oxoethyl]-5-phenylthieno[2,3-b]pyrrole-2-carboxylic acid?
The InChIKey is OFQMOHBSPCNHAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N2O3S/c1-24(2)19(26)14-25-21(16-11-7-4-8-12-16)20(15-9-5-3-6-10-15)17-13-18(23(27)28)29-22(17)25/h4,7-8,11-13,15H,3,5-6,9-10,14H2,1-2H3,(H,27,28).
What are the key properties of 4-cyclohexyl-6-[2-(dimethylamino)-2-oxoethyl]-5-phenylthieno[2,3-b]pyrrole-2-carboxylic acid?
4-cyclohexyl-6-[2-(dimethylamino)-2-oxoethyl]-5-phenylthieno[2,3-b]pyrrole-2-carboxylic acid has a molecular weight of 410.54 g/mol, XLogP of 5.20, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexyl-6-[2-(dimethylamino)-2-oxoethyl]-5-phenylthieno[2,3-b]pyrrole-2-carboxylic acid is sourced from PubChem (CID 11177350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).