C23H44N2O4 — CID 11177418
azanium;(1S,3S,4R)-4-[(4S,7aR)-7a-methyl-4-(methylaminomethyl)-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-3-(hydroxymethyl)-4-methylcyclohexan-1-ol;acetate (PubChem CID 11177418) has the molecular formula C23H44N2O4 and a molecular weight of 412.62 g/mol. Its IUPAC name is azanium;(1S,3S,4R)-4-[(4S,7aR)-7a-methyl-4-(methylaminomethyl)-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-3-(hydroxymethyl)-4-methylcyclohexan-1-ol;acetate.
| Compound Name | azanium;(1S,3S,4R)-4-[(4S,7aR)-7a-methyl-4-(methylaminomethyl)-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-3-(hydroxymethyl)-4-methylcyclohexan-1-ol;acetate |
|---|---|
| PubChem CID | 11177418 |
| Molecular Formula | C23H44N2O4 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.33 |
| IUPAC Name | azanium;(1S,3S,4R)-4-[(4S,7aR)-7a-methyl-4-(methylaminomethyl)-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-3-(hydroxymethyl)-4-methylcyclohexan-1-ol;acetate |
| SMILES | C=C1CCC2[C@@H](CNC)C([C@@]3(C)CC[C@H](O)C[C@@H]3CO)CC[C@@]12C.CC(=O)[O-].[NH4+] |
| InChI | InChI=1S/C21H37NO2.C2H4O2.H3N/c1-14-5-6-18-17(12-22-4)19(8-10-20(14,18)2)21(3)9-7-16(24)11-15(21)13-23;1-2(3)4;/h15-19,22-24H,1,5-13H2,2-4H3;1H3,(H,3,4);1H3/t15-,16+,17-,18?,19?,20+,21+;;/m1../s1 |
| InChIKey | CCHOFMHFRDUFOH-CPGFPIIFSA-N |
| XLogP | 2.50 |
| TPSA | 129.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|