C23H27NO6 — CID 11177436
(2S,3R,4S,5S,6R)-2-[[3-[(4-ethylphenyl)methyl]-1H-indol-4-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 11177436) has the molecular formula C23H27NO6 and a molecular weight of 413.47 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[[3-[(4-ethylphenyl)methyl]-1H-indol-4-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[[3-[(4-ethylphenyl)methyl]-1H-indol-4-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 11177436 |
| Molecular Formula | C23H27NO6 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[[3-[(4-ethylphenyl)methyl]-1H-indol-4-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCc1ccc(Cc2c[nH]c3cccc(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)c23)cc1 |
| InChI | InChI=1S/C23H27NO6/c1-2-13-6-8-14(9-7-13)10-15-11-24-16-4-3-5-17(19(15)16)29-23-22(28)21(27)20(26)18(12-25)30-23/h3-9,11,18,20-28H,2,10,12H2,1H3/t18-,20-,21+,22-,23-/m1/s1 |
| InChIKey | FWPHIPHSHQVZAQ-DODNOZFWSA-N |
| XLogP | 1.50 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |