C21H31N5O — CID 111774556
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[(2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)methyl]-2-methylguanidine (PubChem CID 111774556) has the molecular formula C21H31N5O and a molecular weight of 369.51 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[(2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)methyl]-2-methylguanidine.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[(2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111774556 |
| Molecular Formula | C21H31N5O |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[(2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCCn1nc(C)cc1C)NCc1c(O)ccc2c1CCCC2 |
| InChI | InChI=1S/C21H31N5O/c1-15-13-16(2)26(25-15)12-6-11-23-21(22-3)24-14-19-18-8-5-4-7-17(18)9-10-20(19)27/h9-10,13,27H,4-8,11-12,14H2,1-3H3,(H2,22,23,24) |
| InChIKey | DVNWBGIOGFQHGA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|