C18H35IN6O — CID 111774841
2-methyl-1-[4-(2-methylimidazol-1-yl)butyl]-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 111774841) has the molecular formula C18H35IN6O and a molecular weight of 478.42 g/mol. Its IUPAC name is 2-methyl-1-[4-(2-methylimidazol-1-yl)butyl]-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[4-(2-methylimidazol-1-yl)butyl]-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111774841 |
| Molecular Formula | C18H35IN6O |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 2-methyl-1-[4-(2-methylimidazol-1-yl)butyl]-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCCn1ccnc1C)NCC(C)(C)N1CCOCC1.I |
| InChI | InChI=1S/C18H34N6O.HI/c1-16-20-8-10-23(16)9-6-5-7-21-17(19-4)22-15-18(2,3)24-11-13-25-14-12-24;/h8,10H,5-7,9,11-15H2,1-4H3,(H2,19,21,22);1H |
| InChIKey | KYJLPLULLDXGKS-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|