C24H36IN5O2 — CID 111776845
3-methyl-N-[3-[[N'-methyl-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]propyl]furan-2-carboxamide;hydroiodide (PubChem CID 111776845) has the molecular formula C24H36IN5O2 and a molecular weight of 553.49 g/mol. Its IUPAC name is 3-methyl-N-[3-[[N'-methyl-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]propyl]furan-2-carboxamide;hydroiodide.
| Compound Name | 3-methyl-N-[3-[[N'-methyl-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]propyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111776845 |
| Molecular Formula | C24H36IN5O2 |
| Molecular Weight | 553.49 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | 3-methyl-N-[3-[[N'-methyl-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]propyl]furan-2-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCCCNC(=O)c1occc1C)NCc1ccc(CN2CCCCC2)cc1.I |
| InChI | InChI=1S/C24H35N5O2.HI/c1-19-11-16-31-22(19)23(30)26-12-6-13-27-24(25-2)28-17-20-7-9-21(10-8-20)18-29-14-4-3-5-15-29;/h7-11,16H,3-6,12-15,17-18H2,1-2H3,(H,26,30)(H2,25,27,28);1H |
| InChIKey | HHDWQQINIRILDJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 81.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|