C22H23F2N5O2 — CID 11177823
(5R)-3-[3-fluoro-4-[4-[(3-fluoropropylamino)methyl]phenyl]phenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one (PubChem CID 11177823) has the molecular formula C22H23F2N5O2 and a molecular weight of 427.46 g/mol. Its IUPAC name is (5R)-3-[3-fluoro-4-[4-[(3-fluoropropylamino)methyl]phenyl]phenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | (5R)-3-[3-fluoro-4-[4-[(3-fluoropropylamino)methyl]phenyl]phenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11177823 |
| Molecular Formula | C22H23F2N5O2 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | (5R)-3-[3-fluoro-4-[4-[(3-fluoropropylamino)methyl]phenyl]phenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1O[C@@H](Cn2ccnn2)CN1c1ccc(-c2ccc(CNCCCF)cc2)c(F)c1 |
| InChI | InChI=1S/C22H23F2N5O2/c23-8-1-9-25-13-16-2-4-17(5-3-16)20-7-6-18(12-21(20)24)29-15-19(31-22(29)30)14-28-11-10-26-27-28/h2-7,10-12,19,25H,1,8-9,13-15H2/t19-/m0/s1 |
| InChIKey | XJGCOYXARJFEJD-IBGZPJMESA-N |
| XLogP | 3.56 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|